C26H26N4O3S — CID 20754941
2-[[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 20754941) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-[[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 2-[[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 20754941 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1cccnc1Nc1ccc2c(c1)C(NS(=O)(=O)c1ccc(CC)cc1)CC2 |
| InChI | InChI=1S/C26H26N4O3S/c1-3-15-28-26(31)22-6-5-16-27-25(22)29-20-11-9-19-10-14-24(23(19)17-20)30-34(32,33)21-12-7-18(4-2)8-13-21/h1,5-9,11-13,16-17,24,30H,4,10,14-15H2,2H3,(H,27,29)(H,28,31) |
| InChIKey | PTTYZGNXWOANCF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|