About [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten
[(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten (PubChem CID 20755224) has the molecular formula C11H17W5-
and a molecular weight of 1068.46 g/mol. Its IUPAC name is [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten.
Molecular Properties
| Compound Name | [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten |
| PubChem CID | 20755224 |
| Molecular Formula | C11H17W5- |
| Molecular Weight | 1068.46 g/mol |
| Exact Mass | 1068.89 |
| IUPAC Name | [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten |
| SMILES | CC(C)/[C-]=C/C=C(\C=[W])C(C)C.[W].[W].[W].[W] |
| InChI | InChI=1S/C11H17.5W/c1-9(2)7-6-8-11(5)10(3)4;;;;;/h5-6,8-10H,1-4H3;;;;;/q-1;;;;;/b11-8+;;;;; |
| InChIKey | AAQUUIFPZGQOAV-WEBCDHPFSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1068.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten?
The IUPAC name of [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten (CID 20755224) is [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten.
What is the SMILES notation for [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten?
The canonical SMILES for [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten is CC(C)/[C-]=C/C=C(\C=[W])C(C)C.[W].[W].[W].[W].
What is the InChIKey of [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten?
The InChIKey is AAQUUIFPZGQOAV-WEBCDHPFSA-N. The full InChI is InChI=1S/C11H17.5W/c1-9(2)7-6-8-11(5)10(3)4;;;;;/h5-6,8-10H,1-4H3;;;;;/q-1;;;;;/b11-8+;;;;;.
What are the key properties of [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten?
[(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten has a molecular weight of 1068.46 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-6-methyl-2-propan-2-ylhepta-2,4-dienylidene]tungsten;tungsten is sourced from PubChem (CID 20755224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).