About 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine
2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine (PubChem CID 20755341) has the molecular formula C11H17NS2
and a molecular weight of 227.40 g/mol. Its IUPAC name is 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine |
| PubChem CID | 20755341 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine |
| SMILES | CCSc1cc(C)nc(SCC)c1C |
| InChI | InChI=1S/C11H17NS2/c1-5-13-10-7-8(3)12-11(9(10)4)14-6-2/h7H,5-6H2,1-4H3 |
| InChIKey | WQFHWZZYDFQSHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine?
The IUPAC name of 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine (CID 20755341) is 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine.
What is the SMILES notation for 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine?
The canonical SMILES for 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine is CCSc1cc(C)nc(SCC)c1C.
What is the InChIKey of 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine?
The InChIKey is WQFHWZZYDFQSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS2/c1-5-13-10-7-8(3)12-11(9(10)4)14-6-2/h7H,5-6H2,1-4H3.
What are the key properties of 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine?
2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine has a molecular weight of 227.40 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(ethylsulfanyl)-3,6-dimethylpyridine is sourced from PubChem (CID 20755341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).