C7H14N+ — CID 20756098
1,2,5-trimethyl-2,5-dihydro-1H-pyrrol-1-ium (PubChem CID 20756098) has the molecular formula C7H14N+ and a molecular weight of 112.20 g/mol. Its IUPAC name is 1,2,5-trimethyl-2,5-dihydro-1H-pyrrol-1-ium.
| Compound Name | 1,2,5-trimethyl-2,5-dihydro-1H-pyrrol-1-ium |
|---|---|
| PubChem CID | 20756098 |
| Molecular Formula | C7H14N+ |
| Molecular Weight | 112.20 g/mol |
| Exact Mass | 112.11 |
| IUPAC Name | 1,2,5-trimethyl-2,5-dihydro-1H-pyrrol-1-ium |
| SMILES | CC1C=CC(C)[NH+]1C |
| InChI | InChI=1S/C7H13N/c1-6-4-5-7(2)8(6)3/h4-7H,1-3H3/p+1 |
| InChIKey | GTAFDBOJNGTOIF-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|