C14H20F6O — CID 20756242
1,1,1,3,3,3-hexafluoro-2-[(2,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol (PubChem CID 20756242) has the molecular formula C14H20F6O and a molecular weight of 318.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(2,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(2,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 20756242 |
| Molecular Formula | C14H20F6O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(2,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
| SMILES | CC1C2CC(C1C)C(C)(CC(O)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C14H20F6O/c1-7-8(2)10-4-9(7)5-11(10,3)6-12(21,13(15,16)17)14(18,19)20/h7-10,21H,4-6H2,1-3H3 |
| InChIKey | NKOZKFFFSPWHPQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |