C17H18F10O2 — CID 20756276
(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 20756276) has the molecular formula C17H18F10O2 and a molecular weight of 444.31 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20756276 |
| Molecular Formula | C17H18F10O2 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)methyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCC3C(F)(F)C(F)(F)C(F)(F)C(F)(F)C3(F)F)C(C2)C1C |
| InChI | InChI=1S/C17H18F10O2/c1-6-7(2)9-3-8(6)4-10(9)12(28)29-5-11-13(18,19)15(22,23)17(26,27)16(24,25)14(11,20)21/h6-11H,3-5H2,1-2H3 |
| InChIKey | ANWKCRZJQXSICW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|