C13H18F6O — CID 20756279
2-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 20756279) has the molecular formula C13H18F6O and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 20756279 |
| Molecular Formula | C13H18F6O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1(C)C2CCC(C2)C1CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O/c1-10(2)8-4-3-7(5-8)9(10)6-11(20,12(14,15)16)13(17,18)19/h7-9,20H,3-6H2,1-2H3 |
| InChIKey | FPWVQFWNPAKCCL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |