C25H34N2O7S2Si — CID 20757780
[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]phenyl]methyl methanesulfonate (PubChem CID 20757780) has the molecular formula C25H34N2O7S2Si and a molecular weight of 566.77 g/mol. Its IUPAC name is [4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 20757780 |
| Molecular Formula | C25H34N2O7S2Si |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]phenyl]methyl methanesulfonate |
| SMILES | Cc1noc(N(COCC[Si](C)(C)C)S(=O)(=O)c2ccccc2-c2ccc(COS(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C25H34N2O7S2Si/c1-19-20(2)26-34-25(19)27(18-32-15-16-37(4,5)6)36(30,31)24-10-8-7-9-23(24)22-13-11-21(12-14-22)17-33-35(3,28)29/h7-14H,15-18H2,1-6H3 |
| InChIKey | JVCWVDMSSDTMNR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|