C17H23FN4O4 — CID 20757887
1-N-[2-(3-fluorophenyl)ethyl]-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-methylpyrrolidine-1,2-dicarboxamide (PubChem CID 20757887) has the molecular formula C17H23FN4O4 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-N-[2-(3-fluorophenyl)ethyl]-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-methylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-[2-(3-fluorophenyl)ethyl]-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-methylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20757887 |
| Molecular Formula | C17H23FN4O4 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-N-[2-(3-fluorophenyl)ethyl]-1-N-[2-(hydroxyamino)-2-oxoethyl]-2-N-methylpyrrolidine-1,2-dicarboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)N(CCc1cccc(F)c1)CC(=O)NO |
| InChI | InChI=1S/C17H23FN4O4/c1-19-16(24)14-6-3-8-22(14)17(25)21(11-15(23)20-26)9-7-12-4-2-5-13(18)10-12/h2,4-5,10,14,26H,3,6-9,11H2,1H3,(H,19,24)(H,20,23) |
| InChIKey | PAASLPQOQQCABA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|