C12H18O5SSi — CID 20758025
trimethylsilyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)acetate (PubChem CID 20758025) has the molecular formula C12H18O5SSi and a molecular weight of 302.42 g/mol. Its IUPAC name is trimethylsilyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)acetate.
| Compound Name | trimethylsilyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)acetate |
|---|---|
| PubChem CID | 20758025 |
| Molecular Formula | C12H18O5SSi |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | trimethylsilyl 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)acetate |
| SMILES | C[Si](C)(C)OC(=O)COCC1COc2cscc2O1 |
| InChI | InChI=1S/C12H18O5SSi/c1-19(2,3)17-12(13)6-14-4-9-5-15-10-7-18-8-11(10)16-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | ODVSXIYJDZDXFB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|