About 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one
4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one (PubChem CID 20758375) has the molecular formula C12H18O2S2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one.
Molecular Properties
| Compound Name | 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one |
| PubChem CID | 20758375 |
| Molecular Formula | C12H18O2S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one |
| SMILES | C=S(CCC(CC(C)=O)OC)c1cccs1 |
| InChI | InChI=1S/C12H18O2S2/c1-10(13)9-11(14-2)6-8-16(3)12-5-4-7-15-12/h4-5,7,11H,3,6,8-9H2,1-2H3 |
| InChIKey | RQCKIXMVDHFANS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one?
The IUPAC name of 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one (CID 20758375) is 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one.
What is the SMILES notation for 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one?
The canonical SMILES for 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one is C=S(CCC(CC(C)=O)OC)c1cccs1.
What is the InChIKey of 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one?
The InChIKey is RQCKIXMVDHFANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2S2/c1-10(13)9-11(14-2)6-8-16(3)12-5-4-7-15-12/h4-5,7,11H,3,6,8-9H2,1-2H3.
What are the key properties of 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one?
4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one has a molecular weight of 258.41 g/mol, XLogP of 3.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-[methylidene(thiophen-2-yl)-λ4-sulfanyl]hexan-2-one is sourced from PubChem (CID 20758375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).