C10H21NO — CID 20759366
N,N,2,2,3,3-hexamethylbutanamide (PubChem CID 20759366) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N,N,2,2,3,3-hexamethylbutanamide.
| Compound Name | N,N,2,2,3,3-hexamethylbutanamide |
|---|---|
| PubChem CID | 20759366 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N,N,2,2,3,3-hexamethylbutanamide |
| SMILES | CN(C)C(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-9(2,3)10(4,5)8(12)11(6)7/h1-7H3 |
| InChIKey | KAEZDZKDJOGBPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |