C13H29N2O+ — CID 20759368
trimethyl-[2-(2,2,3,3-tetramethylbutanoylamino)ethyl]azanium (PubChem CID 20759368) has the molecular formula C13H29N2O+ and a molecular weight of 229.39 g/mol. Its IUPAC name is trimethyl-[2-(2,2,3,3-tetramethylbutanoylamino)ethyl]azanium.
| Compound Name | trimethyl-[2-(2,2,3,3-tetramethylbutanoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 20759368 |
| Molecular Formula | C13H29N2O+ |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.23 |
| IUPAC Name | trimethyl-[2-(2,2,3,3-tetramethylbutanoylamino)ethyl]azanium |
| SMILES | CC(C)(C)C(C)(C)C(=O)NCC[N+](C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-12(2,3)13(4,5)11(16)14-9-10-15(6,7)8/h9-10H2,1-8H3/p+1 |
| InChIKey | MIZXGBKPPBBVII-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|