C18H38N2O — CID 20759426
2-tert-butyl-N-[3-[ethyl(methyl)amino]propyl]-2,4,4-trimethylpentanamide (PubChem CID 20759426) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-[ethyl(methyl)amino]propyl]-2,4,4-trimethylpentanamide.
| Compound Name | 2-tert-butyl-N-[3-[ethyl(methyl)amino]propyl]-2,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 20759426 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | 2-tert-butyl-N-[3-[ethyl(methyl)amino]propyl]-2,4,4-trimethylpentanamide |
| SMILES | CCN(C)CCCNC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2O/c1-10-20(9)13-11-12-19-15(21)18(8,17(5,6)7)14-16(2,3)4/h10-14H2,1-9H3,(H,19,21) |
| InChIKey | ZUPBEYDGDAKMLE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|