About 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide
2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide (PubChem CID 20759430) has the molecular formula C16H34N4O
and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide |
| PubChem CID | 20759430 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(C(=O)NCCCCN=C(N)N)C(C)(C)C |
| InChI | InChI=1S/C16H34N4O/c1-15(2,3)11-12(16(4,5)6)13(21)19-9-7-8-10-20-14(17)18/h12H,7-11H2,1-6H3,(H,19,21)(H4,17,18,20) |
| InChIKey | XMSYWWTVGBAXJC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide?
The IUPAC name of 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide (CID 20759430) is 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide.
What is the SMILES notation for 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide?
The canonical SMILES for 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide is CC(C)(C)CC(C(=O)NCCCCN=C(N)N)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide?
The InChIKey is XMSYWWTVGBAXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N4O/c1-15(2,3)11-12(16(4,5)6)13(21)19-9-7-8-10-20-14(17)18/h12H,7-11H2,1-6H3,(H,19,21)(H4,17,18,20).
What are the key properties of 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide?
2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide has a molecular weight of 298.48 g/mol, XLogP of 2.25, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[4-(diaminomethylideneamino)butyl]-4,4-dimethylpentanamide is sourced from PubChem (CID 20759430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).