C99H80N2 — CID 20759573
2-N,2-N,7-N,7-N-tetrakis(9,9-dimethyl-7-phenylfluoren-2-yl)-9,9-dimethylfluorene-2,7-diamine (PubChem CID 20759573) has the molecular formula C99H80N2 and a molecular weight of 1297.74 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis(9,9-dimethyl-7-phenylfluoren-2-yl)-9,9-dimethylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis(9,9-dimethyl-7-phenylfluoren-2-yl)-9,9-dimethylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 20759573 |
| Molecular Formula | C99H80N2 |
| Molecular Weight | 1297.74 g/mol |
| Exact Mass | 1296.63 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis(9,9-dimethyl-7-phenylfluoren-2-yl)-9,9-dimethylfluorene-2,7-diamine |
| SMILES | CC1(C)c2cc(-c3ccccc3)ccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3cc(-c5ccccc5)ccc3-4)c3ccc4c(c3)C(C)(C)c3cc(N(c5ccc6c(c5)C(C)(C)c5cc(-c7ccccc7)ccc5-6)c5ccc6c(c5)C(C)(C)c5cc(-c7ccccc7)ccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C99H80N2/c1-95(2)85-51-65(61-23-15-11-16-24-61)31-41-75(85)79-45-35-69(55-89(79)95)100(70-36-46-80-76-42-32-66(62-25-17-12-18-26-62)52-86(76)96(3,4)90(80)56-70)73-39-49-83-84-50-40-74(60-94(84)99(9,10)93(83)59-73)101(71-37-47-81-77-43-33-67(63-27-19-13-20-28-63)53-87(77)97(5,6)91(81)57-71)72-38-48-82-78-44-34-68(64-29-21-14-22-30-64)54-88(78)98(7,8)92(82)58-72/h11-60H,1-10H3 |
| InChIKey | UYENUUVJLZIBEE-UHFFFAOYSA-N |
| XLogP | 26.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1297.74 |
| LogP ≤ 5 | 26.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |