C17H18F6O2 — CID 20759726
[1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-yl] acetate (PubChem CID 20759726) has the molecular formula C17H18F6O2 and a molecular weight of 368.32 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-yl] acetate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 20759726 |
| Molecular Formula | C17H18F6O2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(C1CC2CC1C1C3C=CC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F6O2/c1-7(24)25-15(16(18,19)20,17(21,22)23)12-6-10-5-11(12)14-9-3-2-8(4-9)13(10)14/h2-3,8-14H,4-6H2,1H3 |
| InChIKey | IGWZPJZMPJAQMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|