C32H32FN3O3S — CID 20760093
N-[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-N-[(2-fluoro-4-pyridinyl)methyl]-3-phenylpropanamide (PubChem CID 20760093) has the molecular formula C32H32FN3O3S and a molecular weight of 557.69 g/mol. Its IUPAC name is N-[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-N-[(2-fluoro-4-pyridinyl)methyl]-3-phenylpropanamide.
| Compound Name | N-[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-N-[(2-fluoro-4-pyridinyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 20760093 |
| Molecular Formula | C32H32FN3O3S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[3-[(4-ethylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-N-[(2-fluoro-4-pyridinyl)methyl]-3-phenylpropanamide |
| SMILES | CCc1ccc(S(=O)(=O)NC2CCc3ccc(N(Cc4ccnc(F)c4)C(=O)CCc4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C32H32FN3O3S/c1-2-23-8-14-28(15-9-23)40(38,39)35-30-16-12-26-11-13-27(21-29(26)30)36(22-25-18-19-34-31(33)20-25)32(37)17-10-24-6-4-3-5-7-24/h3-9,11,13-15,18-21,30,35H,2,10,12,16-17,22H2,1H3 |
| InChIKey | WJIGJLJPMRPSOL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|