About 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile
4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile (PubChem CID 20760296) has the molecular formula C12H24N3+
and a molecular weight of 210.34 g/mol. Its IUPAC name is 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile |
| PubChem CID | 20760296 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile |
| SMILES | CC(C)(C)NC1(C#N)CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C12H24N3/c1-11(2,3)14-12(10-13)6-8-15(4,5)9-7-12/h14H,6-9H2,1-5H3/q+1 |
| InChIKey | IMMJYISFLRMFSJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile?
The IUPAC name of 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile (CID 20760296) is 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile.
What is the SMILES notation for 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile?
The canonical SMILES for 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile is CC(C)(C)NC1(C#N)CC[N+](C)(C)CC1.
What is the InChIKey of 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile?
The InChIKey is IMMJYISFLRMFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N3/c1-11(2,3)14-12(10-13)6-8-15(4,5)9-7-12/h14H,6-9H2,1-5H3/q+1.
What are the key properties of 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile?
4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile has a molecular weight of 210.34 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tert-butylamino)-1,1-dimethylpiperidin-1-ium-4-carbonitrile is sourced from PubChem (CID 20760296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).