About carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+)
carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) (PubChem CID 20760606) has the molecular formula C9H17NOW
and a molecular weight of 339.08 g/mol. Its IUPAC name is carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+).
Molecular Properties
| Compound Name | carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) |
| PubChem CID | 20760606 |
| Molecular Formula | C9H17NOW |
| Molecular Weight | 339.08 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) |
| SMILES | C[N-]C1CCC(C=O)CC1.[CH3-].[W+2] |
| InChI | InChI=1S/C8H14NO.CH3.W/c1-9-8-4-2-7(6-10)3-5-8;;/h6-8H,2-5H2,1H3;1H3;/q2*-1;+2 |
| InChIKey | QBAKOOIQCGQSOC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.08 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+)?
The IUPAC name of carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) (CID 20760606) is carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+).
What is the SMILES notation for carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+)?
The canonical SMILES for carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) is C[N-]C1CCC(C=O)CC1.[CH3-].[W+2].
What is the InChIKey of carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+)?
The InChIKey is QBAKOOIQCGQSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14NO.CH3.W/c1-9-8-4-2-7(6-10)3-5-8;;/h6-8H,2-5H2,1H3;1H3;/q2*-1;+2.
What are the key properties of carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+)?
carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) has a molecular weight of 339.08 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(4-formylcyclohexyl)-methylazanide;tungsten(2+) is sourced from PubChem (CID 20760606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).