C10H11F7O — CID 20760656
4-ethenyl-1,1,1,6-tetrafluoro-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 20760656) has the molecular formula C10H11F7O and a molecular weight of 280.18 g/mol. Its IUPAC name is 4-ethenyl-1,1,1,6-tetrafluoro-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 4-ethenyl-1,1,1,6-tetrafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 20760656 |
| Molecular Formula | C10H11F7O |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-ethenyl-1,1,1,6-tetrafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | C=CC(CC(=C)F)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O/c1-3-7(4-6(2)11)5-8(18,9(12,13)14)10(15,16)17/h3,7,18H,1-2,4-5H2 |
| InChIKey | JMGCIODMLUSFNI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|