About 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide
4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide (PubChem CID 20760743) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide |
| PubChem CID | 20760743 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide |
| SMILES | CCNNC(=O)C1CCC(N2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C13H19N3O3/c1-2-14-15-13(19)9-3-5-10(6-4-9)16-11(17)7-8-12(16)18/h7-10,14H,2-6H2,1H3,(H,15,19) |
| InChIKey | NWZMOQLRXZHPEO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide?
The IUPAC name of 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide (CID 20760743) is 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide.
What is the SMILES notation for 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide?
The canonical SMILES for 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide is CCNNC(=O)C1CCC(N2C(=O)C=CC2=O)CC1.
What is the InChIKey of 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide?
The InChIKey is NWZMOQLRXZHPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-2-14-15-13(19)9-3-5-10(6-4-9)16-11(17)7-8-12(16)18/h7-10,14H,2-6H2,1H3,(H,15,19).
What are the key properties of 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide?
4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide has a molecular weight of 265.31 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrol-1-yl)-N'-ethylcyclohexane-1-carbohydrazide is sourced from PubChem (CID 20760743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).