About 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide
5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide (PubChem CID 20760751) has the molecular formula C14H24N2O3S
and a molecular weight of 300.42 g/mol. Its IUPAC name is 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide.
Molecular Properties
| Compound Name | 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide |
| PubChem CID | 20760751 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide |
| SMILES | CCCCSC1CC(=O)N(CCCCC(=O)NC)C1=O |
| InChI | InChI=1S/C14H24N2O3S/c1-3-4-9-20-11-10-13(18)16(14(11)19)8-6-5-7-12(17)15-2/h11H,3-10H2,1-2H3,(H,15,17) |
| InChIKey | JTTKWTIUVLTYRE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide?
The IUPAC name of 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide (CID 20760751) is 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide.
What is the SMILES notation for 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide?
The canonical SMILES for 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide is CCCCSC1CC(=O)N(CCCCC(=O)NC)C1=O.
What is the InChIKey of 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide?
The InChIKey is JTTKWTIUVLTYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3S/c1-3-4-9-20-11-10-13(18)16(14(11)19)8-6-5-7-12(17)15-2/h11H,3-10H2,1-2H3,(H,15,17).
What are the key properties of 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide?
5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide has a molecular weight of 300.42 g/mol, XLogP of 1.56, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-methylpentanamide is sourced from PubChem (CID 20760751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).