C8H17NO4 — CID 20760770
5-amino-6-ethyl-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 20760770) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-amino-6-ethyl-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | 5-amino-6-ethyl-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 20760770 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 5-amino-6-ethyl-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCC1OC(CO)C(O)C(O)C1N |
| InChI | InChI=1S/C8H17NO4/c1-2-4-6(9)8(12)7(11)5(3-10)13-4/h4-8,10-12H,2-3,9H2,1H3 |
| InChIKey | GGYYIBRZQOEIPC-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |