C13H8F12O2 — CID 20760915
1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propan-2-ol (PubChem CID 20760915) has the molecular formula C13H8F12O2 and a molecular weight of 424.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propan-2-ol |
|---|---|
| PubChem CID | 20760915 |
| Molecular Formula | C13H8F12O2 |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propan-2-ol |
| SMILES | OC(C1=C(C(O)(C(F)(F)F)C(F)(F)F)C2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F12O2/c14-10(15,16)8(26,11(17,18)19)6-4-1-2-5(3-4)7(6)9(27,12(20,21)22)13(23,24)25/h1-2,4-5,26-27H,3H2 |
| InChIKey | FBLAOCJUHGDAEZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|