C59H56N4O — CID 20761167
4-[[4-(diethylamino)phenyl]-[9-(4-methoxyphenyl)carbazol-3-yl]-[9-(4-methylphenyl)carbazol-3-yl]methyl]-N,N-diethylaniline (PubChem CID 20761167) has the molecular formula C59H56N4O and a molecular weight of 837.12 g/mol. Its IUPAC name is 4-[[4-(diethylamino)phenyl]-[9-(4-methoxyphenyl)carbazol-3-yl]-[9-(4-methylphenyl)carbazol-3-yl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-(diethylamino)phenyl]-[9-(4-methoxyphenyl)carbazol-3-yl]-[9-(4-methylphenyl)carbazol-3-yl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 20761167 |
| Molecular Formula | C59H56N4O |
| Molecular Weight | 837.12 g/mol |
| Exact Mass | 836.45 |
| IUPAC Name | 4-[[4-(diethylamino)phenyl]-[9-(4-methoxyphenyl)carbazol-3-yl]-[9-(4-methylphenyl)carbazol-3-yl]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)(c2ccc3c(c2)c2ccccc2n3-c2ccc(C)cc2)c2ccc3c(c2)c2ccccc2n3-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C59H56N4O/c1-7-60(8-2)46-29-21-42(22-30-46)59(43-23-31-47(32-24-43)61(9-3)10-4,44-25-37-57-53(39-44)51-15-11-13-17-55(51)62(57)48-27-19-41(5)20-28-48)45-26-38-58-54(40-45)52-16-12-14-18-56(52)63(58)49-33-35-50(64-6)36-34-49/h11-40H,7-10H2,1-6H3 |
| InChIKey | RWXFNFGZKHFZBK-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 25.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.12 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|