About [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate
[3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate (PubChem CID 20761422) has the molecular formula C22H25F3O4
and a molecular weight of 410.43 g/mol. Its IUPAC name is [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate |
| PubChem CID | 20761422 |
| Molecular Formula | C22H25F3O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate |
| SMILES | Cc1ccc(C)c(C2=C(OC(=O)C(C)C)C3(CCC(C(F)(F)F)CC3)OC2=O)c1 |
| InChI | InChI=1S/C22H25F3O4/c1-12(2)19(26)28-18-17(16-11-13(3)5-6-14(16)4)20(27)29-21(18)9-7-15(8-10-21)22(23,24)25/h5-6,11-12,15H,7-10H2,1-4H3 |
| InChIKey | BNZICKXWFDQSCH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate?
The IUPAC name of [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate (CID 20761422) is [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate.
What is the SMILES notation for [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate?
The canonical SMILES for [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate is Cc1ccc(C)c(C2=C(OC(=O)C(C)C)C3(CCC(C(F)(F)F)CC3)OC2=O)c1.
What is the InChIKey of [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate?
The InChIKey is BNZICKXWFDQSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F3O4/c1-12(2)19(26)28-18-17(16-11-13(3)5-6-14(16)4)20(27)29-21(18)9-7-15(8-10-21)22(23,24)25/h5-6,11-12,15H,7-10H2,1-4H3.
What are the key properties of [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate?
[3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate has a molecular weight of 410.43 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-dimethylphenyl)-2-oxo-8-(trifluoromethyl)-1-oxaspiro[4.5]dec-3-en-4-yl] 2-methylpropanoate is sourced from PubChem (CID 20761422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).