C38H49NO6 — CID 20761488
[2-[(8S,11R,13S,14S,17R)-17-acetyloxy-11-[4-(dimethylamino)phenyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 20761488) has the molecular formula C38H49NO6 and a molecular weight of 615.81 g/mol. Its IUPAC name is [2-[(8S,11R,13S,14S,17R)-17-acetyloxy-11-[4-(dimethylamino)phenyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-[(8S,11R,13S,14S,17R)-17-acetyloxy-11-[4-(dimethylamino)phenyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 20761488 |
| Molecular Formula | C38H49NO6 |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.36 |
| IUPAC Name | [2-[(8S,11R,13S,14S,17R)-17-acetyloxy-11-[4-(dimethylamino)phenyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | CC(=O)O[C@]1(C(=O)COC(=O)CCC2CCCC2)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C38H49NO6/c1-24(40)45-38(34(42)23-44-35(43)18-9-25-7-5-6-8-25)20-19-33-31-16-12-27-21-29(41)15-17-30(27)36(31)32(22-37(33,38)2)26-10-13-28(14-11-26)39(3)4/h10-11,13-14,21,25,31-33H,5-9,12,15-20,22-23H2,1-4H3/t31-,32+,33-,37-,38-/m0/s1 |
| InChIKey | CQBWANDHXRBRRS-MYYQLPNJSA-N |
| XLogP | 7.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|