About 5,7-ditert-butyl-4-methyl-1,4-thiazepane
5,7-ditert-butyl-4-methyl-1,4-thiazepane (PubChem CID 20761819) has the molecular formula C14H29NS
and a molecular weight of 243.46 g/mol. Its IUPAC name is 5,7-ditert-butyl-4-methyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 5,7-ditert-butyl-4-methyl-1,4-thiazepane |
| PubChem CID | 20761819 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 5,7-ditert-butyl-4-methyl-1,4-thiazepane |
| SMILES | CN1CCSC(C(C)(C)C)CC1C(C)(C)C |
| InChI | InChI=1S/C14H29NS/c1-13(2,3)11-10-12(14(4,5)6)16-9-8-15(11)7/h11-12H,8-10H2,1-7H3 |
| InChIKey | ZHEPHKNMJFQJKH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-ditert-butyl-4-methyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butyl-4-methyl-1,4-thiazepane?
The IUPAC name of 5,7-ditert-butyl-4-methyl-1,4-thiazepane (CID 20761819) is 5,7-ditert-butyl-4-methyl-1,4-thiazepane.
What is the SMILES notation for 5,7-ditert-butyl-4-methyl-1,4-thiazepane?
The canonical SMILES for 5,7-ditert-butyl-4-methyl-1,4-thiazepane is CN1CCSC(C(C)(C)C)CC1C(C)(C)C.
What is the InChIKey of 5,7-ditert-butyl-4-methyl-1,4-thiazepane?
The InChIKey is ZHEPHKNMJFQJKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NS/c1-13(2,3)11-10-12(14(4,5)6)16-9-8-15(11)7/h11-12H,8-10H2,1-7H3.
What are the key properties of 5,7-ditert-butyl-4-methyl-1,4-thiazepane?
5,7-ditert-butyl-4-methyl-1,4-thiazepane has a molecular weight of 243.46 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-4-methyl-1,4-thiazepane is sourced from PubChem (CID 20761819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).