C13H23NS — CID 20761824
5,7-ditert-butyl-2,3-dihydro-1,4-thiazepine (PubChem CID 20761824) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 5,7-ditert-butyl-2,3-dihydro-1,4-thiazepine.
| Compound Name | 5,7-ditert-butyl-2,3-dihydro-1,4-thiazepine |
|---|---|
| PubChem CID | 20761824 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 5,7-ditert-butyl-2,3-dihydro-1,4-thiazepine |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)=NCCS1 |
| InChI | InChI=1S/C13H23NS/c1-12(2,3)10-9-11(13(4,5)6)15-8-7-14-10/h9H,7-8H2,1-6H3 |
| InChIKey | NDHPACMWGXNFIG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |