C23H32N2 — CID 20762104
1-N,2-N,4-trimethyl-3,6-bis[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 20762104) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-N,2-N,4-trimethyl-3,6-bis[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,4-trimethyl-3,6-bis[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 20762104 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-N,2-N,4-trimethyl-3,6-bis[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1/C(/C(C)=C/C=C(C)C)=C(C)C=C(/C(C)=C/C=C(C)C)/C1=N\C |
| InChI | InChI=1S/C23H32N2/c1-15(2)10-12-17(5)20-14-19(7)21(18(6)13-11-16(3)4)23(25-9)22(20)24-8/h10-14H,1-9H3/b17-12+,18-13+,24-22+,25-23- |
| InChIKey | REYATAGBNVTKLT-AOGPPVCCSA-N |
| XLogP | 6.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|