C34H54N2 — CID 20762106
1-N,2-N-dimethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 20762106) has the molecular formula C34H54N2 and a molecular weight of 490.82 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N-dimethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 20762106 |
| Molecular Formula | C34H54N2 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 490.43 |
| IUPAC Name | 1-N,2-N-dimethyl-3,6-bis[(E)-4-propan-2-ylidenedec-2-en-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCC(/C=C(\C)C1=CC=C(/C(C)=C/C(CCCCCC)=C(C)C)C(=N/C)/C1=N\C)=C(C)C |
| InChI | InChI=1S/C34H54N2/c1-11-13-15-17-19-29(25(3)4)23-27(7)31-21-22-32(34(36-10)33(31)35-9)28(8)24-30(26(5)6)20-18-16-14-12-2/h21-24H,11-20H2,1-10H3/b27-23+,28-24+,35-33-,36-34- |
| InChIKey | FNNNFFNIWJEQHY-ZAPBLNIGSA-N |
| XLogP | 10.50 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|