C38H54N2 — CID 20762111
1-N,2-N,3-trimethyl-6-[4-(4-methyl-2-octylphenyl)-3-octylphenyl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 20762111) has the molecular formula C38H54N2 and a molecular weight of 538.86 g/mol. Its IUPAC name is 1-N,2-N,3-trimethyl-6-[4-(4-methyl-2-octylphenyl)-3-octylphenyl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,3-trimethyl-6-[4-(4-methyl-2-octylphenyl)-3-octylphenyl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 20762111 |
| Molecular Formula | C38H54N2 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.43 |
| IUPAC Name | 1-N,2-N,3-trimethyl-6-[4-(4-methyl-2-octylphenyl)-3-octylphenyl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCCCc1cc(C)ccc1-c1ccc(C2=CC=C(C)C(=N\C)/C2=N\C)cc1CCCCCCCC |
| InChI | InChI=1S/C38H54N2/c1-7-9-11-13-15-17-19-31-27-29(3)21-24-34(31)35-26-23-33(28-32(35)20-18-16-14-12-10-8-2)36-25-22-30(4)37(39-5)38(36)40-6/h21-28H,7-20H2,1-6H3/b39-37+,40-38- |
| InChIKey | VXFXJYUGIAKNPS-NVXIXPEWSA-N |
| XLogP | 10.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|