C24H10N6O2 — CID 20762343
3,5,10,17,19,24-hexazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione (PubChem CID 20762343) has the molecular formula C24H10N6O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 3,5,10,17,19,24-hexazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione.
| Compound Name | 3,5,10,17,19,24-hexazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione |
|---|---|
| PubChem CID | 20762343 |
| Molecular Formula | C24H10N6O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3,5,10,17,19,24-hexazaoctacyclo[13.13.2.02,10.04,9.012,29.016,24.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,16,18(23),19,21,26(30),27-tridecaene-11,25-dione |
| SMILES | O=c1c2ccc3c4c(ccc(c24)c2nc4ncccc4n12)c(=O)n1c2cccnc2nc31 |
| InChI | InChI=1S/C24H10N6O2/c31-23-13-7-6-12-18-14(24(32)30-16-4-2-10-26-20(16)28-22(12)30)8-5-11(17(13)18)21-27-19-15(29(21)23)3-1-9-25-19/h1-10H |
| InChIKey | NKLUYQYGBORREY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|