C37H34F6O6 — CID 20762613
[4-[2-(4-acetyloxyphenyl)-5-methoxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate (PubChem CID 20762613) has the molecular formula C37H34F6O6 and a molecular weight of 688.66 g/mol. Its IUPAC name is [4-[2-(4-acetyloxyphenyl)-5-methoxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate.
| Compound Name | [4-[2-(4-acetyloxyphenyl)-5-methoxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 20762613 |
| Molecular Formula | C37H34F6O6 |
| Molecular Weight | 688.66 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | [4-[2-(4-acetyloxyphenyl)-5-methoxypentan-2-yl]phenyl] 4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxyphenyl)propan-2-yl]benzoate |
| SMILES | COCCCC(C)(c1ccc(OC(C)=O)cc1)c1ccc(OC(=O)c2ccc(C(c3ccc(OC)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H34F6O6/c1-24(44)48-31-18-10-26(11-19-31)34(2,22-5-23-46-3)27-12-20-32(21-13-27)49-33(45)25-6-8-28(9-7-25)35(36(38,39)40,37(41,42)43)29-14-16-30(47-4)17-15-29/h6-21H,5,22-23H2,1-4H3 |
| InChIKey | PJEBUERZOKDWGY-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.66 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|