C11H17F3N2O5 — CID 20762863
4-hydroxy-5-(methoxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 20762863) has the molecular formula C11H17F3N2O5 and a molecular weight of 314.26 g/mol. Its IUPAC name is 4-hydroxy-5-(methoxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | 4-hydroxy-5-(methoxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 20762863 |
| Molecular Formula | C11H17F3N2O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-hydroxy-5-(methoxymethyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | COCC1OC(C(=O)NCCNC(=O)C(F)(F)F)CC1O |
| InChI | InChI=1S/C11H17F3N2O5/c1-20-5-8-6(17)4-7(21-8)9(18)15-2-3-16-10(19)11(12,13)14/h6-8,17H,2-5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | FWLXZIISUGNHPL-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|