About CID 20762962
CID 20762962 (PubChem CID 20762962) has the molecular formula C4H12Si2Y2
and a molecular weight of 294.12 g/mol.
Molecular Properties
| Compound Name | CID 20762962 |
| PubChem CID | 20762962 |
| Molecular Formula | C4H12Si2Y2 |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 293.86 |
| IUPAC Name | — |
| SMILES | C[Si](C)[Si](C)C.[Y].[Y] |
| InChI | InChI=1S/C4H12Si2.2Y/c1-5(2)6(3)4;;/h1-4H3;; |
| InChIKey | UHDWRYHMTXHWJH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20762962 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20762962?
The IUPAC name of CID 20762962 (CID 20762962) is not available.
What is the SMILES notation for CID 20762962?
The canonical SMILES for CID 20762962 is C[Si](C)[Si](C)C.[Y].[Y].
What is the InChIKey of CID 20762962?
The InChIKey is UHDWRYHMTXHWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12Si2.2Y/c1-5(2)6(3)4;;/h1-4H3;;.
What are the key properties of CID 20762962?
CID 20762962 has a molecular weight of 294.12 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20762962 is sourced from PubChem (CID 20762962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).