About 2-methoxy-N'-methylpropane-1,3-diamine
2-methoxy-N'-methylpropane-1,3-diamine (PubChem CID 20763150) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is 2-methoxy-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-methoxy-N'-methylpropane-1,3-diamine |
| PubChem CID | 20763150 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 2-methoxy-N'-methylpropane-1,3-diamine |
| SMILES | CNCC(CN)OC |
| InChI | InChI=1S/C5H14N2O/c1-7-4-5(3-6)8-2/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | PJOPBAPIWKSZDI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N'-methylpropane-1,3-diamine?
The IUPAC name of 2-methoxy-N'-methylpropane-1,3-diamine (CID 20763150) is 2-methoxy-N'-methylpropane-1,3-diamine.
What is the SMILES notation for 2-methoxy-N'-methylpropane-1,3-diamine?
The canonical SMILES for 2-methoxy-N'-methylpropane-1,3-diamine is CNCC(CN)OC.
What is the InChIKey of 2-methoxy-N'-methylpropane-1,3-diamine?
The InChIKey is PJOPBAPIWKSZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O/c1-7-4-5(3-6)8-2/h5,7H,3-4,6H2,1-2H3.
What are the key properties of 2-methoxy-N'-methylpropane-1,3-diamine?
2-methoxy-N'-methylpropane-1,3-diamine has a molecular weight of 118.18 g/mol, XLogP of -0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 20763150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).