About N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide
N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide (PubChem CID 20763256) has the molecular formula C7H6Br2N2O
and a molecular weight of 293.95 g/mol. Its IUPAC name is N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide.
Molecular Properties
| Compound Name | N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide |
| PubChem CID | 20763256 |
| Molecular Formula | C7H6Br2N2O |
| Molecular Weight | 293.95 g/mol |
| Exact Mass | 291.88 |
| IUPAC Name | N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide |
| SMILES | ON/C=N/c1ccc(Br)cc1Br |
| InChI | InChI=1S/C7H6Br2N2O/c8-5-1-2-7(6(9)3-5)10-4-11-12/h1-4,12H,(H,10,11) |
| InChIKey | LIKVBVFQBBMETA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide?
The IUPAC name of N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide (CID 20763256) is N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide.
What is the SMILES notation for N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide?
The canonical SMILES for N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide is ON/C=N/c1ccc(Br)cc1Br.
What is the InChIKey of N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide?
The InChIKey is LIKVBVFQBBMETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2N2O/c8-5-1-2-7(6(9)3-5)10-4-11-12/h1-4,12H,(H,10,11).
What are the key properties of N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide?
N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide has a molecular weight of 293.95 g/mol, XLogP of 2.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,4-dibromophenyl)-N-hydroxymethanimidamide is sourced from PubChem (CID 20763256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).