C17H26N2O2 — CID 20763356
N'-[4-(3,7-dimethyloct-6-enoxy)phenyl]-N-hydroxymethanimidamide (PubChem CID 20763356) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N'-[4-(3,7-dimethyloct-6-enoxy)phenyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[4-(3,7-dimethyloct-6-enoxy)phenyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 20763356 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N'-[4-(3,7-dimethyloct-6-enoxy)phenyl]-N-hydroxymethanimidamide |
| SMILES | CC(C)=CCCC(C)CCOc1ccc(/N=C/NO)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16(8-10-17)18-13-19-20/h5,7-10,13,15,20H,4,6,11-12H2,1-3H3,(H,18,19) |
| InChIKey | KSJGERNTIUETJG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|