C8H13F5N2 — CID 20763650
2,2,3,3,3-pentafluoro-1-(1-methylpyrrolidin-3-yl)propan-1-amine (PubChem CID 20763650) has the molecular formula C8H13F5N2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(1-methylpyrrolidin-3-yl)propan-1-amine.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(1-methylpyrrolidin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 20763650 |
| Molecular Formula | C8H13F5N2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(1-methylpyrrolidin-3-yl)propan-1-amine |
| SMILES | CN1CCC(C(N)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F5N2/c1-15-3-2-5(4-15)6(14)7(9,10)8(11,12)13/h5-6H,2-4,14H2,1H3 |
| InChIKey | KVWAMGVPZBNWAR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|