C19H18FN3 — CID 20763871
1-[4-(4-fluorophenyl)but-1-en-3-yn-2-yl]-4-pyridin-2-ylpiperazine (PubChem CID 20763871) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)but-1-en-3-yn-2-yl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[4-(4-fluorophenyl)but-1-en-3-yn-2-yl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 20763871 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[4-(4-fluorophenyl)but-1-en-3-yn-2-yl]-4-pyridin-2-ylpiperazine |
| SMILES | C=C(C#Cc1ccc(F)cc1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H18FN3/c1-16(5-6-17-7-9-18(20)10-8-17)22-12-14-23(15-13-22)19-4-2-3-11-21-19/h2-4,7-11H,1,12-15H2 |
| InChIKey | RHGMFASYQJOGNU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|