C39H39F3N6 — CID 20763968
N-(1H-benzimidazol-2-ylmethyl)-N-[[4-[[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylamino]methyl]phenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 20763968) has the molecular formula C39H39F3N6 and a molecular weight of 648.78 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-N-[[4-[[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylamino]methyl]phenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-N-[[4-[[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylamino]methyl]phenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 20763968 |
| Molecular Formula | C39H39F3N6 |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-N-[[4-[[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylamino]methyl]phenyl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | Cc1cc(CNCc2ccc(CN(Cc3nc4ccccc4[nH]3)C3CCCc4cccnc43)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H39F3N6/c1-26-20-31(27(2)48(26)33-11-6-10-32(21-33)39(40,41)42)23-43-22-28-15-17-29(18-16-28)24-47(25-37-45-34-12-3-4-13-35(34)46-37)36-14-5-8-30-9-7-19-44-38(30)36/h3-4,6-7,9-13,15-21,36,43H,5,8,14,22-25H2,1-2H3,(H,45,46) |
| InChIKey | RRPRCOUQUGNPIZ-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|