About ethyl nona-1,2-dien-4-yl carbonate
ethyl nona-1,2-dien-4-yl carbonate (PubChem CID 20765132) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl nona-1,2-dien-4-yl carbonate.
Molecular Properties
| Compound Name | ethyl nona-1,2-dien-4-yl carbonate |
| PubChem CID | 20765132 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl nona-1,2-dien-4-yl carbonate |
| SMILES | C=C=CC(CCCCC)OC(=O)OCC |
| InChI | InChI=1S/C12H20O3/c1-4-7-8-10-11(9-5-2)15-12(13)14-6-3/h9,11H,2,4,6-8,10H2,1,3H3 |
| InChIKey | GKJNCMCSVMQWAO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl nona-1,2-dien-4-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl nona-1,2-dien-4-yl carbonate?
The IUPAC name of ethyl nona-1,2-dien-4-yl carbonate (CID 20765132) is ethyl nona-1,2-dien-4-yl carbonate.
What is the SMILES notation for ethyl nona-1,2-dien-4-yl carbonate?
The canonical SMILES for ethyl nona-1,2-dien-4-yl carbonate is C=C=CC(CCCCC)OC(=O)OCC.
What is the InChIKey of ethyl nona-1,2-dien-4-yl carbonate?
The InChIKey is GKJNCMCSVMQWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-7-8-10-11(9-5-2)15-12(13)14-6-3/h9,11H,2,4,6-8,10H2,1,3H3.
What are the key properties of ethyl nona-1,2-dien-4-yl carbonate?
ethyl nona-1,2-dien-4-yl carbonate has a molecular weight of 212.29 g/mol, XLogP of 3.45, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl nona-1,2-dien-4-yl carbonate is sourced from PubChem (CID 20765132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).