About ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate
ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate (PubChem CID 20765143) has the molecular formula C10H18O3Si
and a molecular weight of 214.34 g/mol. Its IUPAC name is ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate.
Molecular Properties
| Compound Name | ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate |
| PubChem CID | 20765143 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate |
| SMILES | C=C=C(COC(=O)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O3Si/c1-6-9(14(3,4)5)8-13-10(11)12-7-2/h1,7-8H2,2-5H3 |
| InChIKey | OOQGTOAXJGIRNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate?
The IUPAC name of ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate (CID 20765143) is ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate.
What is the SMILES notation for ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate?
The canonical SMILES for ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate is C=C=C(COC(=O)OCC)[Si](C)(C)C.
What is the InChIKey of ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate?
The InChIKey is OOQGTOAXJGIRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3Si/c1-6-9(14(3,4)5)8-13-10(11)12-7-2/h1,7-8H2,2-5H3.
What are the key properties of ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate?
ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate has a molecular weight of 214.34 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-trimethylsilylbuta-2,3-dienyl carbonate is sourced from PubChem (CID 20765143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).