C15H30S — CID 20765243
(E)-1-(3,3-dimethylbutan-2-ylsulfanyl)-6,6-dimethylhept-2-ene (PubChem CID 20765243) has the molecular formula C15H30S and a molecular weight of 242.47 g/mol. Its IUPAC name is (E)-1-(3,3-dimethylbutan-2-ylsulfanyl)-6,6-dimethylhept-2-ene.
| Compound Name | (E)-1-(3,3-dimethylbutan-2-ylsulfanyl)-6,6-dimethylhept-2-ene |
|---|---|
| PubChem CID | 20765243 |
| Molecular Formula | C15H30S |
| Molecular Weight | 242.47 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (E)-1-(3,3-dimethylbutan-2-ylsulfanyl)-6,6-dimethylhept-2-ene |
| SMILES | CC(SC/C=C/CCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30S/c1-13(15(5,6)7)16-12-10-8-9-11-14(2,3)4/h8,10,13H,9,11-12H2,1-7H3/b10-8+ |
| InChIKey | UQNPFHZXNUAXKW-CSKARUKUSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|