C19H17ClO4S — CID 20765614
(E)-3-[2-chloro-4-(2-methoxyphenyl)sulfanyl-6-prop-2-enoxyphenyl]prop-2-enoic acid (PubChem CID 20765614) has the molecular formula C19H17ClO4S and a molecular weight of 376.86 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-(2-methoxyphenyl)sulfanyl-6-prop-2-enoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-4-(2-methoxyphenyl)sulfanyl-6-prop-2-enoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20765614 |
| Molecular Formula | C19H17ClO4S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (E)-3-[2-chloro-4-(2-methoxyphenyl)sulfanyl-6-prop-2-enoxyphenyl]prop-2-enoic acid |
| SMILES | C=CCOc1cc(Sc2ccccc2OC)cc(Cl)c1/C=C/C(=O)O |
| InChI | InChI=1S/C19H17ClO4S/c1-3-10-24-17-12-13(11-15(20)14(17)8-9-19(21)22)25-18-7-5-4-6-16(18)23-2/h3-9,11-12H,1,10H2,2H3,(H,21,22)/b9-8+ |
| InChIKey | IGYHXMDQOIHCKO-CMDGGOBGSA-N |
| XLogP | 5.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|