About 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine
6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 20765668) has the molecular formula C19H21ClFN3O3S
and a molecular weight of 425.91 g/mol. Its IUPAC name is 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 20765668 |
| Molecular Formula | C19H21ClFN3O3S |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCOc2c(N3CCNCC3)cc(Cl)cc21 |
| InChI | InChI=1S/C19H21ClFN3O3S/c1-13-2-3-15(21)12-18(13)28(25,26)24-8-9-27-19-16(10-14(20)11-17(19)24)23-6-4-22-5-7-23/h2-3,10-12,22H,4-9H2,1H3 |
| InChIKey | JPTJJZCZKZDYTP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine (CID 20765668) is 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine is Cc1ccc(F)cc1S(=O)(=O)N1CCOc2c(N3CCNCC3)cc(Cl)cc21.
What is the InChIKey of 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is JPTJJZCZKZDYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClFN3O3S/c1-13-2-3-15(21)12-18(13)28(25,26)24-8-9-27-19-16(10-14(20)11-17(19)24)23-6-4-22-5-7-23/h2-3,10-12,22H,4-9H2,1H3.
What are the key properties of 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine?
6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 425.91 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(5-fluoro-2-methylphenyl)sulfonyl-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 20765668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).