About 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol
2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol (PubChem CID 20765951) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol.
Molecular Properties
| Compound Name | 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol |
| PubChem CID | 20765951 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol |
| SMILES | CC(C)C1CCc2cc(S)ccc2O1 |
| InChI | InChI=1S/C12H16OS/c1-8(2)11-5-3-9-7-10(14)4-6-12(9)13-11/h4,6-8,11,14H,3,5H2,1-2H3 |
| InChIKey | LGXMNAOJIKJTQW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol?
The IUPAC name of 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol (CID 20765951) is 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol.
What is the SMILES notation for 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol?
The canonical SMILES for 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol is CC(C)C1CCc2cc(S)ccc2O1.
What is the InChIKey of 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol?
The InChIKey is LGXMNAOJIKJTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS/c1-8(2)11-5-3-9-7-10(14)4-6-12(9)13-11/h4,6-8,11,14H,3,5H2,1-2H3.
What are the key properties of 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol?
2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol has a molecular weight of 208.33 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-3,4-dihydro-2H-chromene-6-thiol is sourced from PubChem (CID 20765951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).