C34H22O6 — CID 20766146
13,16-dimethoxy-5,24-dimethyl-9,20-dioxoheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10(28),11,13,15,17,19(27),21(26),22,24-tridecaene-11,18-dicarbaldehyde (PubChem CID 20766146) has the molecular formula C34H22O6 and a molecular weight of 526.54 g/mol. Its IUPAC name is 13,16-dimethoxy-5,24-dimethyl-9,20-dioxoheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10(28),11,13,15,17,19(27),21(26),22,24-tridecaene-11,18-dicarbaldehyde.
| Compound Name | 13,16-dimethoxy-5,24-dimethyl-9,20-dioxoheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10(28),11,13,15,17,19(27),21(26),22,24-tridecaene-11,18-dicarbaldehyde |
|---|---|
| PubChem CID | 20766146 |
| Molecular Formula | C34H22O6 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 13,16-dimethoxy-5,24-dimethyl-9,20-dioxoheptacyclo[13.11.1.12,10.03,8.019,27.021,26.014,28]octacosa-1,3(8),4,6,10(28),11,13,15,17,19(27),21(26),22,24-tridecaene-11,18-dicarbaldehyde |
| SMILES | COc1cc(C=O)c2c(=O)c3ccc(C)cc3c3c2c1c1c(OC)cc(C=O)c2c(=O)c4ccc(C)cc4c3c21 |
| InChI | InChI=1S/C34H22O6/c1-15-5-7-19-21(9-15)27-28-22-10-16(2)6-8-20(22)34(38)26-18(14-36)12-24(40-4)30(32(26)28)29-23(39-3)11-17(13-35)25(31(27)29)33(19)37/h5-14H,1-4H3 |
| InChIKey | DHODMGKJYDYFQI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|